C21H21NO5S — CID 8950032
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-(4-methoxyphenyl)sulfanylacetate (PubChem CID 8950032) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-(4-methoxyphenyl)sulfanylacetate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-(4-methoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8950032 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-(4-methoxyphenyl)sulfanylacetate |
| SMILES | COc1ccc(SCC(=O)OCC(=O)c2ccc(N3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C21H21NO5S/c1-26-17-8-10-18(11-9-17)28-14-21(25)27-13-19(23)15-4-6-16(7-5-15)22-12-2-3-20(22)24/h4-11H,2-3,12-14H2,1H3 |
| InChIKey | GNNZBYJDJAPVTP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |