C22H21NO5 — CID 8650975
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 8650975) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8650975 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)c2ccc(N3CCCC3=O)cc2)c1 |
| InChI | InChI=1S/C22H21NO5/c1-27-19-5-2-4-16(14-19)7-12-22(26)28-15-20(24)17-8-10-18(11-9-17)23-13-3-6-21(23)25/h2,4-5,7-12,14H,3,6,13,15H2,1H3/b12-7+ |
| InChIKey | SDJYBRWMRUAZGE-KPKJPENVSA-N |
| XLogP | 3.26 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|