C29H43NO5S — CID 145057705
2,5-dihydroxypentyl 5-propylthiophene-2-carboxylate;1-(4-hexylphenyl)pyrrolidin-2-one (PubChem CID 145057705) has the molecular formula C29H43NO5S and a molecular weight of 517.73 g/mol. Its IUPAC name is 2,5-dihydroxypentyl 5-propylthiophene-2-carboxylate;1-(4-hexylphenyl)pyrrolidin-2-one.
| Compound Name | 2,5-dihydroxypentyl 5-propylthiophene-2-carboxylate;1-(4-hexylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 145057705 |
| Molecular Formula | C29H43NO5S |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 2,5-dihydroxypentyl 5-propylthiophene-2-carboxylate;1-(4-hexylphenyl)pyrrolidin-2-one |
| SMILES | CCCCCCc1ccc(N2CCCC2=O)cc1.CCCc1ccc(C(=O)OCC(O)CCCO)s1 |
| InChI | InChI=1S/C16H23NO.C13H20O4S/c1-2-3-4-5-7-14-9-11-15(12-10-14)17-13-6-8-16(17)18;1-2-4-11-6-7-12(18-11)13(16)17-9-10(15)5-3-8-14/h9-12H,2-8,13H2,1H3;6-7,10,14-15H,2-5,8-9H2,1H3 |
| InChIKey | APVPHPRZDKSSBQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|