C26H36O3S — CID 143552410
(3S)-3-(4-hexylphenyl)cyclopentan-1-one;methyl 5-propylthiophene-2-carboxylate (PubChem CID 143552410) has the molecular formula C26H36O3S and a molecular weight of 428.64 g/mol. Its IUPAC name is (3S)-3-(4-hexylphenyl)cyclopentan-1-one;methyl 5-propylthiophene-2-carboxylate.
| Compound Name | (3S)-3-(4-hexylphenyl)cyclopentan-1-one;methyl 5-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 143552410 |
| Molecular Formula | C26H36O3S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (3S)-3-(4-hexylphenyl)cyclopentan-1-one;methyl 5-propylthiophene-2-carboxylate |
| SMILES | CCCCCCc1ccc([C@H]2CCC(=O)C2)cc1.CCCc1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C17H24O.C9H12O2S/c1-2-3-4-5-6-14-7-9-15(10-8-14)16-11-12-17(18)13-16;1-3-4-7-5-6-8(12-7)9(10)11-2/h7-10,16H,2-6,11-13H2,1H3;5-6H,3-4H2,1-2H3/t16-;/m0./s1 |
| InChIKey | RLTXTWPCULSFNN-NTISSMGPSA-N |
| XLogP | 7.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|