C26H32O3S — CID 143942260
methyl 5-[3-[2-[4-[(E)-hex-1-enyl]phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 143942260) has the molecular formula C26H32O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is methyl 5-[3-[2-[4-[(E)-hex-1-enyl]phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[2-[4-[(E)-hex-1-enyl]phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 143942260 |
| Molecular Formula | C26H32O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | methyl 5-[3-[2-[4-[(E)-hex-1-enyl]phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CCCC/C=C/c1ccc(C2C(=O)CCC2CCCc2ccc(C(=O)OC)s2)cc1 |
| InChI | InChI=1S/C26H32O3S/c1-3-4-5-6-8-19-11-13-21(14-12-19)25-20(15-17-23(25)27)9-7-10-22-16-18-24(30-22)26(28)29-2/h6,8,11-14,16,18,20,25H,3-5,7,9-10,15,17H2,1-2H3/b8-6+ |
| InChIKey | JOYJAXAHYQSHKN-SOFGYWHQSA-N |
| XLogP | 6.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|