About phenacyl thiophene-2-carboxylate
phenacyl thiophene-2-carboxylate (PubChem CID 570654) has the molecular formula C13H10O3S
and a molecular weight of 246.29 g/mol. Its IUPAC name is phenacyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | phenacyl thiophene-2-carboxylate |
| PubChem CID | 570654 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | phenacyl thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C13H10O3S/c14-11(10-5-2-1-3-6-10)9-16-13(15)12-7-4-8-17-12/h1-8H,9H2 |
| InChIKey | SGPCEFGITALHGC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenacyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl thiophene-2-carboxylate?
The IUPAC name of phenacyl thiophene-2-carboxylate (CID 570654) is phenacyl thiophene-2-carboxylate.
What is the SMILES notation for phenacyl thiophene-2-carboxylate?
The canonical SMILES for phenacyl thiophene-2-carboxylate is O=C(COC(=O)c1cccs1)c1ccccc1.
What is the InChIKey of phenacyl thiophene-2-carboxylate?
The InChIKey is SGPCEFGITALHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3S/c14-11(10-5-2-1-3-6-10)9-16-13(15)12-7-4-8-17-12/h1-8H,9H2.
What are the key properties of phenacyl thiophene-2-carboxylate?
phenacyl thiophene-2-carboxylate has a molecular weight of 246.29 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl thiophene-2-carboxylate is sourced from PubChem (CID 570654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).