C31H47NO6S — CID 145057688
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-propylthiophene-2-carboxylate;1-(4-hexylphenyl)pyrrolidin-2-one;methanol (PubChem CID 145057688) has the molecular formula C31H47NO6S and a molecular weight of 561.79 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-propylthiophene-2-carboxylate;1-(4-hexylphenyl)pyrrolidin-2-one;methanol.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-propylthiophene-2-carboxylate;1-(4-hexylphenyl)pyrrolidin-2-one;methanol |
|---|---|
| PubChem CID | 145057688 |
| Molecular Formula | C31H47NO6S |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 5-propylthiophene-2-carboxylate;1-(4-hexylphenyl)pyrrolidin-2-one;methanol |
| SMILES | CCCCCCc1ccc(N2CCCC2=O)cc1.CCCc1ccc(C(=O)OCC2COC(C)(C)O2)s1.CO |
| InChI | InChI=1S/C16H23NO.C14H20O4S.CH4O/c1-2-3-4-5-7-14-9-11-15(12-10-14)17-13-6-8-16(17)18;1-4-5-11-6-7-12(19-11)13(15)16-8-10-9-17-14(2,3)18-10;1-2/h9-12H,2-8,13H2,1H3;6-7,10H,4-5,8-9H2,1-3H3;2H,1H3 |
| InChIKey | KVNDDUDFXCLYFM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|