C31H47NO7S — CID 145057758
1-[4-[(1S)-1-hydroxyhexyl]phenyl]pyrrolidin-2-one;3,4,6-trihydroxyhexyl 5-butylthiophene-2-carboxylate (PubChem CID 145057758) has the molecular formula C31H47NO7S and a molecular weight of 577.78 g/mol. Its IUPAC name is 1-[4-[(1S)-1-hydroxyhexyl]phenyl]pyrrolidin-2-one;3,4,6-trihydroxyhexyl 5-butylthiophene-2-carboxylate.
| Compound Name | 1-[4-[(1S)-1-hydroxyhexyl]phenyl]pyrrolidin-2-one;3,4,6-trihydroxyhexyl 5-butylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 145057758 |
| Molecular Formula | C31H47NO7S |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 1-[4-[(1S)-1-hydroxyhexyl]phenyl]pyrrolidin-2-one;3,4,6-trihydroxyhexyl 5-butylthiophene-2-carboxylate |
| SMILES | CCCCC[C@H](O)c1ccc(N2CCCC2=O)cc1.CCCCc1ccc(C(=O)OCCC(O)C(O)CCO)s1 |
| InChI | InChI=1S/C16H23NO2.C15H24O5S/c1-2-3-4-6-15(18)13-8-10-14(11-9-13)17-12-5-7-16(17)19;1-2-3-4-11-5-6-14(21-11)15(19)20-10-8-13(18)12(17)7-9-16/h8-11,15,18H,2-7,12H2,1H3;5-6,12-13,16-18H,2-4,7-10H2,1H3/t15-;/m0./s1 |
| InChIKey | ALTLMRCCNKUCED-RSAXXLAASA-N |
| XLogP | 5.17 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|