C26H34N2O5S — CID 24748704
propan-2-yl 5-[3-[3-[4-(1-hydroxyhexyl)phenyl]-2,5-dioxoimidazolidin-4-yl]propyl]thiophene-2-carboxylate (PubChem CID 24748704) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is propan-2-yl 5-[3-[3-[4-(1-hydroxyhexyl)phenyl]-2,5-dioxoimidazolidin-4-yl]propyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[3-[3-[4-(1-hydroxyhexyl)phenyl]-2,5-dioxoimidazolidin-4-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24748704 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | propan-2-yl 5-[3-[3-[4-(1-hydroxyhexyl)phenyl]-2,5-dioxoimidazolidin-4-yl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(O)c1ccc(N2C(=O)NC(=O)C2CCCc2ccc(C(=O)OC(C)C)s2)cc1 |
| InChI | InChI=1S/C26H34N2O5S/c1-4-5-6-10-22(29)18-11-13-19(14-12-18)28-21(24(30)27-26(28)32)9-7-8-20-15-16-23(34-20)25(31)33-17(2)3/h11-17,21-22,29H,4-10H2,1-3H3,(H,27,30,32) |
| InChIKey | WYWNQAGBBPVQMT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|