C25H33NO4S — CID 89294122
3-[4-[(1S)-1-hydroxyhexyl]phenyl]-2-[3-[5-(1-methoxyethenyl)thiophen-2-yl]propyl]-1,3-oxazolidin-4-one (PubChem CID 89294122) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is 3-[4-[(1S)-1-hydroxyhexyl]phenyl]-2-[3-[5-(1-methoxyethenyl)thiophen-2-yl]propyl]-1,3-oxazolidin-4-one.
| Compound Name | 3-[4-[(1S)-1-hydroxyhexyl]phenyl]-2-[3-[5-(1-methoxyethenyl)thiophen-2-yl]propyl]-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 89294122 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 3-[4-[(1S)-1-hydroxyhexyl]phenyl]-2-[3-[5-(1-methoxyethenyl)thiophen-2-yl]propyl]-1,3-oxazolidin-4-one |
| SMILES | C=C(OC)c1ccc(CCCC2OCC(=O)N2c2ccc([C@@H](O)CCCCC)cc2)s1 |
| InChI | InChI=1S/C25H33NO4S/c1-4-5-6-9-22(27)19-11-13-20(14-12-19)26-24(28)17-30-25(26)10-7-8-21-15-16-23(31-21)18(2)29-3/h11-16,22,25,27H,2,4-10,17H2,1,3H3/t22-,25?/m0/s1 |
| InChIKey | ZNAWPWTZNICOTM-XADRRFQNSA-N |
| XLogP | 5.69 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|