C27H36INO4S — CID 67018048
propan-2-yl 5-[3-[1-[4-[(1S)-1-hydroxy-1-iodohexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate (PubChem CID 67018048) has the molecular formula C27H36INO4S and a molecular weight of 597.56 g/mol. Its IUPAC name is propan-2-yl 5-[3-[1-[4-[(1S)-1-hydroxy-1-iodohexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[3-[1-[4-[(1S)-1-hydroxy-1-iodohexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 67018048 |
| Molecular Formula | C27H36INO4S |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | propan-2-yl 5-[3-[1-[4-[(1S)-1-hydroxy-1-iodohexyl]phenyl]-5-oxopyrrolidin-2-yl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCC[C@](O)(I)c1ccc(N2C(=O)CCC2CCCc2ccc(C(=O)OC(C)C)s2)cc1 |
| InChI | InChI=1S/C27H36INO4S/c1-4-5-6-18-27(28,32)20-10-12-22(13-11-20)29-21(14-17-25(29)30)8-7-9-23-15-16-24(34-23)26(31)33-19(2)3/h10-13,15-16,19,21,32H,4-9,14,17-18H2,1-3H3/t21?,27-/m1/s1 |
| InChIKey | WNZVDMNQDYKKLP-IAIRZMIISA-N |
| XLogP | 6.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|