C25H34N2O4S2 — CID 75240605
propan-2-yl 2-[2-[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate (PubChem CID 75240605) has the molecular formula C25H34N2O4S2 and a molecular weight of 490.69 g/mol. Its IUPAC name is propan-2-yl 2-[2-[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate.
| Compound Name | propan-2-yl 2-[2-[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 75240605 |
| Molecular Formula | C25H34N2O4S2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | propan-2-yl 2-[2-[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCC(O)c1ccc(N2C(=O)CCC2CCSc2nc(C(=O)OC(C)C)cs2)cc1 |
| InChI | InChI=1S/C25H34N2O4S2/c1-4-5-6-7-22(28)18-8-10-19(11-9-18)27-20(12-13-23(27)29)14-15-32-25-26-21(16-33-25)24(30)31-17(2)3/h8-11,16-17,20,22,28H,4-7,12-15H2,1-3H3 |
| InChIKey | JUEHXUMTVALYNC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|