C25H31NO5 — CID 70667399
3-[[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]methoxymethyl]benzoic acid (PubChem CID 70667399) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-[[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]methoxymethyl]benzoic acid.
| Compound Name | 3-[[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]methoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 70667399 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 3-[[1-[4-(1-hydroxyhexyl)phenyl]-5-oxopyrrolidin-2-yl]methoxymethyl]benzoic acid |
| SMILES | CCCCCC(O)c1ccc(N2C(=O)CCC2COCc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H31NO5/c1-2-3-4-8-23(27)19-9-11-21(12-10-19)26-22(13-14-24(26)28)17-31-16-18-6-5-7-20(15-18)25(29)30/h5-7,9-12,15,22-23,27H,2-4,8,13-14,16-17H2,1H3,(H,29,30) |
| InChIKey | MVXIIKRUEDTRBN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|