C25H33NO3 — CID 143851696
6-[(3-ethoxyphenyl)methyl]-1-[4-(1-hydroxypentyl)phenyl]piperidin-2-one (PubChem CID 143851696) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is 6-[(3-ethoxyphenyl)methyl]-1-[4-(1-hydroxypentyl)phenyl]piperidin-2-one.
| Compound Name | 6-[(3-ethoxyphenyl)methyl]-1-[4-(1-hydroxypentyl)phenyl]piperidin-2-one |
|---|---|
| PubChem CID | 143851696 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 6-[(3-ethoxyphenyl)methyl]-1-[4-(1-hydroxypentyl)phenyl]piperidin-2-one |
| SMILES | CCCCC(O)c1ccc(N2C(=O)CCCC2Cc2cccc(OCC)c2)cc1 |
| InChI | InChI=1S/C25H33NO3/c1-3-5-11-24(27)20-13-15-21(16-14-20)26-22(9-7-12-25(26)28)17-19-8-6-10-23(18-19)29-4-2/h6,8,10,13-16,18,22,24,27H,3-5,7,9,11-12,17H2,1-2H3 |
| InChIKey | FKBHZDLBKNJHRT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |