C23H29N2O7P — CID 70852472
[3-[[3-[4-(1-hydroxypentyl)phenyl]-1-methyl-2,5-dioxoimidazolidin-4-yl]methoxymethyl]phenyl] dihydrogen phosphite (PubChem CID 70852472) has the molecular formula C23H29N2O7P and a molecular weight of 476.47 g/mol. Its IUPAC name is [3-[[3-[4-(1-hydroxypentyl)phenyl]-1-methyl-2,5-dioxoimidazolidin-4-yl]methoxymethyl]phenyl] dihydrogen phosphite.
| Compound Name | [3-[[3-[4-(1-hydroxypentyl)phenyl]-1-methyl-2,5-dioxoimidazolidin-4-yl]methoxymethyl]phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 70852472 |
| Molecular Formula | C23H29N2O7P |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [3-[[3-[4-(1-hydroxypentyl)phenyl]-1-methyl-2,5-dioxoimidazolidin-4-yl]methoxymethyl]phenyl] dihydrogen phosphite |
| SMILES | CCCCC(O)c1ccc(N2C(=O)N(C)C(=O)C2COCc2cccc(OP(O)O)c2)cc1 |
| InChI | InChI=1S/C23H29N2O7P/c1-3-4-8-21(26)17-9-11-18(12-10-17)25-20(22(27)24(2)23(25)28)15-31-14-16-6-5-7-19(13-16)32-33(29)30/h5-7,9-13,20-21,26,29-30H,3-4,8,14-15H2,1-2H3 |
| InChIKey | PVCBQXCSNMTPMB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|