C22H38O4 — CID 121321971
3-[[3-[[(2S)-2-hydroxyheptan-3-yl]oxymethyl]phenyl]methoxy]heptan-2-ol (PubChem CID 121321971) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 3-[[3-[[(2S)-2-hydroxyheptan-3-yl]oxymethyl]phenyl]methoxy]heptan-2-ol.
| Compound Name | 3-[[3-[[(2S)-2-hydroxyheptan-3-yl]oxymethyl]phenyl]methoxy]heptan-2-ol |
|---|---|
| PubChem CID | 121321971 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 3-[[3-[[(2S)-2-hydroxyheptan-3-yl]oxymethyl]phenyl]methoxy]heptan-2-ol |
| SMILES | CCCCC(OCc1cccc(COC(CCCC)[C@H](C)O)c1)C(C)O |
| InChI | InChI=1S/C22H38O4/c1-5-7-12-21(17(3)23)25-15-19-10-9-11-20(14-19)16-26-22(18(4)24)13-8-6-2/h9-11,14,17-18,21-24H,5-8,12-13,15-16H2,1-4H3/t17-,18?,21?,22?/m0/s1 |
| InChIKey | VAGRJOOZLCRPAC-JCNCLCQRSA-N |
| XLogP | 4.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |