C18H26O5 — CID 14992256
methyl (5S,6S)-5-hydroxy-3-oxo-6-phenylmethoxydecanoate (PubChem CID 14992256) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is methyl (5S,6S)-5-hydroxy-3-oxo-6-phenylmethoxydecanoate.
| Compound Name | methyl (5S,6S)-5-hydroxy-3-oxo-6-phenylmethoxydecanoate |
|---|---|
| PubChem CID | 14992256 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | methyl (5S,6S)-5-hydroxy-3-oxo-6-phenylmethoxydecanoate |
| SMILES | CCCC[C@H](OCc1ccccc1)[C@@H](O)CC(=O)CC(=O)OC |
| InChI | InChI=1S/C18H26O5/c1-3-4-10-17(23-13-14-8-6-5-7-9-14)16(20)11-15(19)12-18(21)22-2/h5-9,16-17,20H,3-4,10-13H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | HKPOQMZEFXOWMS-IRXDYDNUSA-N |
| XLogP | 2.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|