C19H24O5 — CID 174718709
ethane-1,2-diol;methyl 3-phenyl-3-phenylmethoxypropanoate (PubChem CID 174718709) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethane-1,2-diol;methyl 3-phenyl-3-phenylmethoxypropanoate.
| Compound Name | ethane-1,2-diol;methyl 3-phenyl-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 174718709 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | ethane-1,2-diol;methyl 3-phenyl-3-phenylmethoxypropanoate |
| SMILES | COC(=O)CC(OCc1ccccc1)c1ccccc1.OCCO |
| InChI | InChI=1S/C17H18O3.C2H6O2/c1-19-17(18)12-16(15-10-6-3-7-11-15)20-13-14-8-4-2-5-9-14;3-1-2-4/h2-11,16H,12-13H2,1H3;3-4H,1-2H2 |
| InChIKey | FWTKTQUYVZASFG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |