methyl 4-bromo-3-phenylmethoxybutanoate

C12H15BrO3 — CID 23256163

IUPACmethyl 4-bromo-3-phenylmethoxybutanoate
SMILESCOC(=O)CC(CBr)OCc1ccccc1
InChIInChI=1S/C12H15BrO3/c1-15-12(14)7-11(8-13)16-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3
InChIKeyIXXYOFZJKCMLMX-UHFFFAOYSA-N
MW287.15 g/mol
LogP2.53
Rot. Bonds6

About methyl 4-bromo-3-phenylmethoxybutanoate

methyl 4-bromo-3-phenylmethoxybutanoate (PubChem CID 23256163) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is methyl 4-bromo-3-phenylmethoxybutanoate.

Molecular Properties

Compound Namemethyl 4-bromo-3-phenylmethoxybutanoate
PubChem CID23256163
Molecular FormulaC12H15BrO3
Molecular Weight287.15 g/mol
Exact Mass286.02
IUPAC Namemethyl 4-bromo-3-phenylmethoxybutanoate
SMILESCOC(=O)CC(CBr)OCc1ccccc1
InChIInChI=1S/C12H15BrO3/c1-15-12(14)7-11(8-13)16-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3
InChIKeyIXXYOFZJKCMLMX-UHFFFAOYSA-N
XLogP2.53
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.15
LogP ≤ 52.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 4-bromo-3-phenylmethoxybutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-3-phenylmethoxybutanoate?
The IUPAC name of methyl 4-bromo-3-phenylmethoxybutanoate (CID 23256163) is methyl 4-bromo-3-phenylmethoxybutanoate.
What is the SMILES notation for methyl 4-bromo-3-phenylmethoxybutanoate?
The canonical SMILES for methyl 4-bromo-3-phenylmethoxybutanoate is COC(=O)CC(CBr)OCc1ccccc1.
What is the InChIKey of methyl 4-bromo-3-phenylmethoxybutanoate?
The InChIKey is IXXYOFZJKCMLMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO3/c1-15-12(14)7-11(8-13)16-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3.
What are the key properties of methyl 4-bromo-3-phenylmethoxybutanoate?
methyl 4-bromo-3-phenylmethoxybutanoate has a molecular weight of 287.15 g/mol, XLogP of 2.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-3-phenylmethoxybutanoate is sourced from PubChem (CID 23256163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).