C15H19NO6 — CID 10828664
methyl (3R)-3-acetyloxy-4-(phenylmethoxycarbonylamino)butanoate (PubChem CID 10828664) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is methyl (3R)-3-acetyloxy-4-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (3R)-3-acetyloxy-4-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 10828664 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | methyl (3R)-3-acetyloxy-4-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)C[C@H](CNC(=O)OCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C15H19NO6/c1-11(17)22-13(8-14(18)20-2)9-16-15(19)21-10-12-6-4-3-5-7-12/h3-7,13H,8-10H2,1-2H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | HUYMPNMBROPWAY-CYBMUJFWSA-N |
| XLogP | 1.41 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|