C23H31NO4S — CID 71038756
(5S)-4-hydroxy-1-[4-(1-hydroxyhexyl)phenyl]-5-[(5-methylthiophen-2-yl)methoxymethyl]pyrrolidin-2-one (PubChem CID 71038756) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is (5S)-4-hydroxy-1-[4-(1-hydroxyhexyl)phenyl]-5-[(5-methylthiophen-2-yl)methoxymethyl]pyrrolidin-2-one.
| Compound Name | (5S)-4-hydroxy-1-[4-(1-hydroxyhexyl)phenyl]-5-[(5-methylthiophen-2-yl)methoxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71038756 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | (5S)-4-hydroxy-1-[4-(1-hydroxyhexyl)phenyl]-5-[(5-methylthiophen-2-yl)methoxymethyl]pyrrolidin-2-one |
| SMILES | CCCCCC(O)c1ccc(N2C(=O)CC(O)[C@@H]2COCc2ccc(C)s2)cc1 |
| InChI | InChI=1S/C23H31NO4S/c1-3-4-5-6-21(25)17-8-10-18(11-9-17)24-20(22(26)13-23(24)27)15-28-14-19-12-7-16(2)29-19/h7-12,20-22,25-26H,3-6,13-15H2,1-2H3/t20-,21?,22?/m0/s1 |
| InChIKey | NKQALFDGUVVNQO-HWELCPFYSA-N |
| XLogP | 4.35 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|