C22H28ClNO4S — CID 24812055
5-[[3-chloro-1-[4-(1-hydroxypentyl)phenyl]pyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylic acid (PubChem CID 24812055) has the molecular formula C22H28ClNO4S and a molecular weight of 437.99 g/mol. Its IUPAC name is 5-[[3-chloro-1-[4-(1-hydroxypentyl)phenyl]pyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[3-chloro-1-[4-(1-hydroxypentyl)phenyl]pyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 24812055 |
| Molecular Formula | C22H28ClNO4S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 5-[[3-chloro-1-[4-(1-hydroxypentyl)phenyl]pyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylic acid |
| SMILES | CCCCC(O)c1ccc(N2CCC(Cl)C2COCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C22H28ClNO4S/c1-2-3-4-20(25)15-5-7-16(8-6-15)24-12-11-18(23)19(24)14-28-13-17-9-10-21(29-17)22(26)27/h5-10,18-20,25H,2-4,11-14H2,1H3,(H,26,27) |
| InChIKey | HKAJQMBRMHFEDN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|