C21H30ClNO3S — CID 24811278
(E)-7-[3-chloro-1-[4-(1-hydroxy-3-methylsulfanylpropyl)phenyl]pyrrolidin-2-yl]hept-5-enoic acid (PubChem CID 24811278) has the molecular formula C21H30ClNO3S and a molecular weight of 412.00 g/mol. Its IUPAC name is (E)-7-[3-chloro-1-[4-(1-hydroxy-3-methylsulfanylpropyl)phenyl]pyrrolidin-2-yl]hept-5-enoic acid.
| Compound Name | (E)-7-[3-chloro-1-[4-(1-hydroxy-3-methylsulfanylpropyl)phenyl]pyrrolidin-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 24811278 |
| Molecular Formula | C21H30ClNO3S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (E)-7-[3-chloro-1-[4-(1-hydroxy-3-methylsulfanylpropyl)phenyl]pyrrolidin-2-yl]hept-5-enoic acid |
| SMILES | CSCCC(O)c1ccc(N2CCC(Cl)C2C/C=C/CCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H30ClNO3S/c1-27-15-13-20(24)16-8-10-17(11-9-16)23-14-12-18(22)19(23)6-4-2-3-5-7-21(25)26/h2,4,8-11,18-20,24H,3,5-7,12-15H2,1H3,(H,25,26)/b4-2+ |
| InChIKey | FYCCOBSSVRYBRS-DUXPYHPUSA-N |
| XLogP | 4.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|