C23H40ClNO2 — CID 142257131
(Z)-7-[(2S,3R)-3-chloro-1-[(4R)-4-(1-propylcyclobutyl)pentyl]pyrrolidin-2-yl]hept-5-enoic acid (PubChem CID 142257131) has the molecular formula C23H40ClNO2 and a molecular weight of 398.03 g/mol. Its IUPAC name is (Z)-7-[(2S,3R)-3-chloro-1-[(4R)-4-(1-propylcyclobutyl)pentyl]pyrrolidin-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2S,3R)-3-chloro-1-[(4R)-4-(1-propylcyclobutyl)pentyl]pyrrolidin-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 142257131 |
| Molecular Formula | C23H40ClNO2 |
| Molecular Weight | 398.03 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | (Z)-7-[(2S,3R)-3-chloro-1-[(4R)-4-(1-propylcyclobutyl)pentyl]pyrrolidin-2-yl]hept-5-enoic acid |
| SMILES | CCCC1([C@H](C)CCCN2CC[C@@H](Cl)[C@@H]2C/C=C\CCCC(=O)O)CCC1 |
| InChI | InChI=1S/C23H40ClNO2/c1-3-14-23(15-9-16-23)19(2)10-8-17-25-18-13-20(24)21(25)11-6-4-5-7-12-22(26)27/h4,6,19-21H,3,5,7-18H2,1-2H3,(H,26,27)/b6-4-/t19-,20-,21+/m1/s1 |
| InChIKey | WGYZFAHLQYWNCK-DIWIJMCBSA-N |
| XLogP | 6.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.03 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|