8-methylnon-5-enoic acid

C10H18O2 — CID 73188771

IUPAC8-methylnon-5-enoic acid
SMILESCC(C)CC=CCCCC(=O)O
InChIInChI=1S/C10H18O2/c1-9(2)7-5-3-4-6-8-10(11)12/h3,5,9H,4,6-8H2,1-2H3,(H,11,12)
InChIKeyVLJOKWJZTAVCLC-UHFFFAOYSA-N
MW170.25 g/mol
LogP2.84
Rot. Bonds6

About 8-methylnon-5-enoic acid

8-methylnon-5-enoic acid (PubChem CID 73188771) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 8-methylnon-5-enoic acid.

Molecular Properties

Compound Name8-methylnon-5-enoic acid
PubChem CID73188771
Molecular FormulaC10H18O2
Molecular Weight170.25 g/mol
Exact Mass170.13
IUPAC Name8-methylnon-5-enoic acid
SMILESCC(C)CC=CCCCC(=O)O
InChIInChI=1S/C10H18O2/c1-9(2)7-5-3-4-6-8-10(11)12/h3,5,9H,4,6-8H2,1-2H3,(H,11,12)
InChIKeyVLJOKWJZTAVCLC-UHFFFAOYSA-N
XLogP2.84
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.25
LogP ≤ 52.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 8-methylnon-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-methylnon-5-enoic acid?
The IUPAC name of 8-methylnon-5-enoic acid (CID 73188771) is 8-methylnon-5-enoic acid.
What is the SMILES notation for 8-methylnon-5-enoic acid?
The canonical SMILES for 8-methylnon-5-enoic acid is CC(C)CC=CCCCC(=O)O.
What is the InChIKey of 8-methylnon-5-enoic acid?
The InChIKey is VLJOKWJZTAVCLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-9(2)7-5-3-4-6-8-10(11)12/h3,5,9H,4,6-8H2,1-2H3,(H,11,12).
What are the key properties of 8-methylnon-5-enoic acid?
8-methylnon-5-enoic acid has a molecular weight of 170.25 g/mol, XLogP of 2.84, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnon-5-enoic acid is sourced from PubChem (CID 73188771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).