C16H26O3 — CID 20579712
(5E,11E,13E)-15-hydroxyhexadeca-5,11,13-trienoic acid (PubChem CID 20579712) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (5E,11E,13E)-15-hydroxyhexadeca-5,11,13-trienoic acid.
| Compound Name | (5E,11E,13E)-15-hydroxyhexadeca-5,11,13-trienoic acid |
|---|---|
| PubChem CID | 20579712 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (5E,11E,13E)-15-hydroxyhexadeca-5,11,13-trienoic acid |
| SMILES | CC(O)/C=C/C=C/CCCC/C=C/CCCC(=O)O |
| InChI | InChI=1S/C16H26O3/c1-15(17)13-11-9-7-5-3-2-4-6-8-10-12-14-16(18)19/h6-9,11,13,15,17H,2-5,10,12,14H2,1H3,(H,18,19)/b8-6+,9-7+,13-11+ |
| InChIKey | ZPMISZRGUYLTKY-UGPPIYERSA-N |
| XLogP | 3.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|