C14H22O3S — CID 59977211
(Z)-7-[(2Z,4E)-6-hydroxyhepta-2,4-dienyl]sulfanylhept-5-enoic acid (PubChem CID 59977211) has the molecular formula C14H22O3S and a molecular weight of 270.39 g/mol. Its IUPAC name is (Z)-7-[(2Z,4E)-6-hydroxyhepta-2,4-dienyl]sulfanylhept-5-enoic acid.
| Compound Name | (Z)-7-[(2Z,4E)-6-hydroxyhepta-2,4-dienyl]sulfanylhept-5-enoic acid |
|---|---|
| PubChem CID | 59977211 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (Z)-7-[(2Z,4E)-6-hydroxyhepta-2,4-dienyl]sulfanylhept-5-enoic acid |
| SMILES | CC(O)/C=C/C=C\CSC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C14H22O3S/c1-13(15)9-5-4-8-12-18-11-7-3-2-6-10-14(16)17/h3-5,7-9,13,15H,2,6,10-12H2,1H3,(H,16,17)/b7-3-,8-4-,9-5+ |
| InChIKey | BMZDTQQNFWDCPH-SOWBGYEJSA-N |
| XLogP | 3.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|