C17H26O3 — CID 20579782
(E)-7-[2-[(2E,4E)-6-hydroxyhepta-2,4-dienyl]cyclopropyl]hept-5-enoic acid (PubChem CID 20579782) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (E)-7-[2-[(2E,4E)-6-hydroxyhepta-2,4-dienyl]cyclopropyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[(2E,4E)-6-hydroxyhepta-2,4-dienyl]cyclopropyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 20579782 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (E)-7-[2-[(2E,4E)-6-hydroxyhepta-2,4-dienyl]cyclopropyl]hept-5-enoic acid |
| SMILES | CC(O)/C=C/C=C/CC1CC1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C17H26O3/c1-14(18)9-5-4-7-11-16-13-15(16)10-6-2-3-8-12-17(19)20/h2,4-7,9,14-16,18H,3,8,10-13H2,1H3,(H,19,20)/b6-2+,7-4+,9-5+ |
| InChIKey | GLNZEIUWPXXAGS-SXCJESDKSA-N |
| XLogP | 3.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|