C14H20O3 — CID 12988297
(2E,4E,9E,11E,13S)-13-hydroxytetradeca-2,4,9,11-tetraenoic acid (PubChem CID 12988297) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2E,4E,9E,11E,13S)-13-hydroxytetradeca-2,4,9,11-tetraenoic acid.
| Compound Name | (2E,4E,9E,11E,13S)-13-hydroxytetradeca-2,4,9,11-tetraenoic acid |
|---|---|
| PubChem CID | 12988297 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2E,4E,9E,11E,13S)-13-hydroxytetradeca-2,4,9,11-tetraenoic acid |
| SMILES | C[C@H](O)/C=C/C=C/CCC/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C14H20O3/c1-13(15)11-9-7-5-3-2-4-6-8-10-12-14(16)17/h5-13,15H,2-4H2,1H3,(H,16,17)/b7-5+,8-6+,11-9+,12-10+/t13-/m0/s1 |
| InChIKey | HSBANENAPNAFDZ-DDPSBCTDSA-N |
| XLogP | 2.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|