C21H38O2 — CID 170315585
19-methylicosa-2,4-dienoic acid (PubChem CID 170315585) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 19-methylicosa-2,4-dienoic acid.
| Compound Name | 19-methylicosa-2,4-dienoic acid |
|---|---|
| PubChem CID | 170315585 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | 19-methylicosa-2,4-dienoic acid |
| SMILES | CC(C)CCCCCCCCCCCCCC=CC=CC(=O)O |
| InChI | InChI=1S/C21H38O2/c1-20(2)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21(22)23/h13,15,17,19-20H,3-12,14,16,18H2,1-2H3,(H,22,23) |
| InChIKey | XSNAHXWDHYPOIE-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|