C28H48O2 — CID 100915751
(5Z,9Z,19Z,21Z)-octacosa-5,9,19,21-tetraenoic acid (PubChem CID 100915751) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is (5Z,9Z,19Z,21Z)-octacosa-5,9,19,21-tetraenoic acid.
| Compound Name | (5Z,9Z,19Z,21Z)-octacosa-5,9,19,21-tetraenoic acid |
|---|---|
| PubChem CID | 100915751 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | (5Z,9Z,19Z,21Z)-octacosa-5,9,19,21-tetraenoic acid |
| SMILES | CCCCCC/C=C\C=C/CCCCCCCC/C=C\CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C28H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h7-10,19-20,23-24H,2-6,11-18,21-22,25-27H2,1H3,(H,29,30)/b8-7-,10-9-,20-19-,24-23- |
| InChIKey | HJBKCZVMMDPCBN-KFQWGOOCSA-N |
| XLogP | 9.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|