C14H24ClNO3 — CID 59659406
(Z)-7-[(2S,3R)-3-chloro-1-(3-hydroxypropyl)pyrrolidin-2-yl]hept-5-enoic acid (PubChem CID 59659406) has the molecular formula C14H24ClNO3 and a molecular weight of 289.80 g/mol. Its IUPAC name is (Z)-7-[(2S,3R)-3-chloro-1-(3-hydroxypropyl)pyrrolidin-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2S,3R)-3-chloro-1-(3-hydroxypropyl)pyrrolidin-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59659406 |
| Molecular Formula | C14H24ClNO3 |
| Molecular Weight | 289.80 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (Z)-7-[(2S,3R)-3-chloro-1-(3-hydroxypropyl)pyrrolidin-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H](Cl)CCN1CCCO |
| InChI | InChI=1S/C14H24ClNO3/c15-12-8-10-16(9-5-11-17)13(12)6-3-1-2-4-7-14(18)19/h1,3,12-13,17H,2,4-11H2,(H,18,19)/b3-1-/t12-,13+/m1/s1 |
| InChIKey | KYPYESPZUQHGNN-APDIZUKHSA-N |
| XLogP | 2.25 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.80 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|