About 8-hydroxyoct-5-enoic acid
8-hydroxyoct-5-enoic acid (PubChem CID 86081855) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 8-hydroxyoct-5-enoic acid.
Molecular Properties
| Compound Name | 8-hydroxyoct-5-enoic acid |
| PubChem CID | 86081855 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 8-hydroxyoct-5-enoic acid |
| SMILES | O=C(O)CCCC=CCCO |
| InChI | InChI=1S/C8H14O3/c9-7-5-3-1-2-4-6-8(10)11/h1,3,9H,2,4-7H2,(H,10,11) |
| InChIKey | NMWHGTRTJQHXGY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxyoct-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxyoct-5-enoic acid?
The IUPAC name of 8-hydroxyoct-5-enoic acid (CID 86081855) is 8-hydroxyoct-5-enoic acid.
What is the SMILES notation for 8-hydroxyoct-5-enoic acid?
The canonical SMILES for 8-hydroxyoct-5-enoic acid is O=C(O)CCCC=CCCO.
What is the InChIKey of 8-hydroxyoct-5-enoic acid?
The InChIKey is NMWHGTRTJQHXGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c9-7-5-3-1-2-4-6-8(10)11/h1,3,9H,2,4-7H2,(H,10,11).
What are the key properties of 8-hydroxyoct-5-enoic acid?
8-hydroxyoct-5-enoic acid has a molecular weight of 158.20 g/mol, XLogP of 1.18, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxyoct-5-enoic acid is sourced from PubChem (CID 86081855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).