8-hydroxyoct-5-enoic acid

C8H14O3 — CID 86081855

IUPAC8-hydroxyoct-5-enoic acid
SMILESO=C(O)CCCC=CCCO
InChIInChI=1S/C8H14O3/c9-7-5-3-1-2-4-6-8(10)11/h1,3,9H,2,4-7H2,(H,10,11)
InChIKeyNMWHGTRTJQHXGY-UHFFFAOYSA-N
MW158.20 g/mol
LogP1.18
Rot. Bonds6

About 8-hydroxyoct-5-enoic acid

8-hydroxyoct-5-enoic acid (PubChem CID 86081855) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 8-hydroxyoct-5-enoic acid.

Molecular Properties

Compound Name8-hydroxyoct-5-enoic acid
PubChem CID86081855
Molecular FormulaC8H14O3
Molecular Weight158.20 g/mol
Exact Mass158.09
IUPAC Name8-hydroxyoct-5-enoic acid
SMILESO=C(O)CCCC=CCCO
InChIInChI=1S/C8H14O3/c9-7-5-3-1-2-4-6-8(10)11/h1,3,9H,2,4-7H2,(H,10,11)
InChIKeyNMWHGTRTJQHXGY-UHFFFAOYSA-N
XLogP1.18
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 51.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 8-hydroxyoct-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-hydroxyoct-5-enoic acid?
The IUPAC name of 8-hydroxyoct-5-enoic acid (CID 86081855) is 8-hydroxyoct-5-enoic acid.
What is the SMILES notation for 8-hydroxyoct-5-enoic acid?
The canonical SMILES for 8-hydroxyoct-5-enoic acid is O=C(O)CCCC=CCCO.
What is the InChIKey of 8-hydroxyoct-5-enoic acid?
The InChIKey is NMWHGTRTJQHXGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c9-7-5-3-1-2-4-6-8(10)11/h1,3,9H,2,4-7H2,(H,10,11).
What are the key properties of 8-hydroxyoct-5-enoic acid?
8-hydroxyoct-5-enoic acid has a molecular weight of 158.20 g/mol, XLogP of 1.18, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxyoct-5-enoic acid is sourced from PubChem (CID 86081855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).