C25H37ClO2 — CID 91224333
7-[3-chloro-2-(4-heptan-2-ylphenyl)cyclopentyl]hept-5-enoic acid (PubChem CID 91224333) has the molecular formula C25H37ClO2 and a molecular weight of 405.02 g/mol. Its IUPAC name is 7-[3-chloro-2-(4-heptan-2-ylphenyl)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[3-chloro-2-(4-heptan-2-ylphenyl)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91224333 |
| Molecular Formula | C25H37ClO2 |
| Molecular Weight | 405.02 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 7-[3-chloro-2-(4-heptan-2-ylphenyl)cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(C)c1ccc(C2C(Cl)CCC2CC=CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C25H37ClO2/c1-3-4-7-10-19(2)20-13-15-22(16-14-20)25-21(17-18-23(25)26)11-8-5-6-9-12-24(27)28/h5,8,13-16,19,21,23,25H,3-4,6-7,9-12,17-18H2,1-2H3,(H,27,28) |
| InChIKey | IEXOUTKHWRZZEL-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.02 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|