C24H36Cl2O3 — CID 143863383
1-[4-[(1S,2S,4S)-2,4-dichlorocyclopentyl]phenyl]hexan-1-ol;(Z)-hept-5-enoic acid (PubChem CID 143863383) has the molecular formula C24H36Cl2O3 and a molecular weight of 443.46 g/mol. Its IUPAC name is 1-[4-[(1S,2S,4S)-2,4-dichlorocyclopentyl]phenyl]hexan-1-ol;(Z)-hept-5-enoic acid.
| Compound Name | 1-[4-[(1S,2S,4S)-2,4-dichlorocyclopentyl]phenyl]hexan-1-ol;(Z)-hept-5-enoic acid |
|---|---|
| PubChem CID | 143863383 |
| Molecular Formula | C24H36Cl2O3 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-[4-[(1S,2S,4S)-2,4-dichlorocyclopentyl]phenyl]hexan-1-ol;(Z)-hept-5-enoic acid |
| SMILES | C/C=C\CCCC(=O)O.CCCCCC(O)c1ccc([C@@H]2C[C@H](Cl)C[C@@H]2Cl)cc1 |
| InChI | InChI=1S/C17H24Cl2O.C7H12O2/c1-2-3-4-5-17(20)13-8-6-12(7-9-13)15-10-14(18)11-16(15)19;1-2-3-4-5-6-7(8)9/h6-9,14-17,20H,2-5,10-11H2,1H3;2-3H,4-6H2,1H3,(H,8,9)/b;3-2-/t14-,15-,16-,17?;/m0./s1 |
| InChIKey | CUHXQQFRSQVWOM-LYSJZAJMSA-N |
| XLogP | 7.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|