C22H33ClO4 — CID 89148440
5-[(3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]pentanoic acid (PubChem CID 89148440) has the molecular formula C22H33ClO4 and a molecular weight of 396.96 g/mol. Its IUPAC name is 5-[(3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]pentanoic acid.
| Compound Name | 5-[(3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]pentanoic acid |
|---|---|
| PubChem CID | 89148440 |
| Molecular Formula | C22H33ClO4 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 5-[(3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]pentanoic acid |
| SMILES | CCCCCC(O)c1ccc(C2C(CCCCC(=O)O)[C@H](Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C22H33ClO4/c1-2-3-4-8-19(24)15-10-12-16(13-11-15)22-17(18(23)14-20(22)25)7-5-6-9-21(26)27/h10-13,17-20,22,24-25H,2-9,14H2,1H3,(H,26,27)/t17?,18-,19?,20-,22?/m1/s1 |
| InChIKey | YAKYWHJHTKEXBP-RVIADUHASA-N |
| XLogP | 5.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|