C27H41ClO4 — CID 76579762
7-[5-chloro-2-[4-(3-cyclohexyl-1-hydroxypropyl)phenyl]-3-hydroxycyclopentyl]heptanoic acid (PubChem CID 76579762) has the molecular formula C27H41ClO4 and a molecular weight of 465.07 g/mol. Its IUPAC name is 7-[5-chloro-2-[4-(3-cyclohexyl-1-hydroxypropyl)phenyl]-3-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[5-chloro-2-[4-(3-cyclohexyl-1-hydroxypropyl)phenyl]-3-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 76579762 |
| Molecular Formula | C27H41ClO4 |
| Molecular Weight | 465.07 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 7-[5-chloro-2-[4-(3-cyclohexyl-1-hydroxypropyl)phenyl]-3-hydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(Cl)CC(O)C1c1ccc(C(O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H41ClO4/c28-23-18-25(30)27(22(23)10-6-1-2-7-11-26(31)32)21-15-13-20(14-16-21)24(29)17-12-19-8-4-3-5-9-19/h13-16,19,22-25,27,29-30H,1-12,17-18H2,(H,31,32) |
| InChIKey | OHPFYLCKWNHNGB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.07 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|