C26H39ClO4 — CID 23549468
methyl 7-[5-chloro-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxycyclopentyl]heptanoate (PubChem CID 23549468) has the molecular formula C26H39ClO4 and a molecular weight of 451.05 g/mol. Its IUPAC name is methyl 7-[5-chloro-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[5-chloro-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 23549468 |
| Molecular Formula | C26H39ClO4 |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | methyl 7-[5-chloro-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxycyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(Cl)CC(O)C1c1ccc(C(O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H39ClO4/c1-31-24(29)12-8-3-2-7-11-21-22(27)17-23(28)25(21)18-13-15-20(16-14-18)26(30)19-9-5-4-6-10-19/h13-16,19,21-23,25-26,28,30H,2-12,17H2,1H3 |
| InChIKey | JHUZQUMJNPQVQM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|