C27H41ClO4 — CID 23549443
methyl 7-[5-chloro-3-hydroxy-2-[3-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]cyclopentyl]heptanoate (PubChem CID 23549443) has the molecular formula C27H41ClO4 and a molecular weight of 465.07 g/mol. Its IUPAC name is methyl 7-[5-chloro-3-hydroxy-2-[3-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[5-chloro-3-hydroxy-2-[3-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 23549443 |
| Molecular Formula | C27H41ClO4 |
| Molecular Weight | 465.07 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | methyl 7-[5-chloro-3-hydroxy-2-[3-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]cyclopentyl]heptanoate |
| SMILES | CCCC1(C(O)c2cccc(C3C(O)CC(Cl)C3CCCCCCC(=O)OC)c2)CCC1 |
| InChI | InChI=1S/C27H41ClO4/c1-3-14-27(15-9-16-27)26(31)20-11-8-10-19(17-20)25-21(22(28)18-23(25)29)12-6-4-5-7-13-24(30)32-2/h8,10-11,17,21-23,25-26,29,31H,3-7,9,12-16,18H2,1-2H3 |
| InChIKey | PAZBGXZBOAQSBR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.07 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|