C28H41NO5 — CID 23549484
(E)-N-(2-hydroxyethyl)-7-[3-hydroxy-2-[3-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-5-oxocyclopentyl]hept-5-enamide (PubChem CID 23549484) has the molecular formula C28H41NO5 and a molecular weight of 471.64 g/mol. Its IUPAC name is (E)-N-(2-hydroxyethyl)-7-[3-hydroxy-2-[3-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-5-oxocyclopentyl]hept-5-enamide.
| Compound Name | (E)-N-(2-hydroxyethyl)-7-[3-hydroxy-2-[3-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-5-oxocyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 23549484 |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | (E)-N-(2-hydroxyethyl)-7-[3-hydroxy-2-[3-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-5-oxocyclopentyl]hept-5-enamide |
| SMILES | CCCC1(C(O)c2cccc(C3C(O)CC(=O)C3C/C=C/CCCC(=O)NCCO)c2)CCC1 |
| InChI | InChI=1S/C28H41NO5/c1-2-13-28(14-8-15-28)27(34)21-10-7-9-20(18-21)26-22(23(31)19-24(26)32)11-5-3-4-6-12-25(33)29-16-17-30/h3,5,7,9-10,18,22,24,26-27,30,32,34H,2,4,6,8,11-17,19H2,1H3,(H,29,33)/b5-3+ |
| InChIKey | BQTKCNWHZNZDKI-HWKANZROSA-N |
| XLogP | 3.95 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|