C27H37ClO3 — CID 129084012
methyl (Z)-7-[(1R,2S)-2-[3-[1-[1-(2-chloroethyl)cyclobutyl]ethyl]phenyl]-5-oxocyclopentyl]hept-5-enoate (PubChem CID 129084012) has the molecular formula C27H37ClO3 and a molecular weight of 445.04 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S)-2-[3-[1-[1-(2-chloroethyl)cyclobutyl]ethyl]phenyl]-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S)-2-[3-[1-[1-(2-chloroethyl)cyclobutyl]ethyl]phenyl]-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 129084012 |
| Molecular Formula | C27H37ClO3 |
| Molecular Weight | 445.04 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | methyl (Z)-7-[(1R,2S)-2-[3-[1-[1-(2-chloroethyl)cyclobutyl]ethyl]phenyl]-5-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(=O)CC[C@@H]1c1cccc(C(C)C2(CCCl)CCC2)c1 |
| InChI | InChI=1S/C27H37ClO3/c1-20(27(17-18-28)15-8-16-27)21-9-7-10-22(19-21)23-13-14-25(29)24(23)11-5-3-4-6-12-26(30)31-2/h3,5,7,9-10,19-20,23-24H,4,6,8,11-18H2,1-2H3/b5-3-/t20?,23-,24-/m1/s1 |
| InChIKey | DDISPFQELJOSKC-WEAAFPNISA-N |
| XLogP | 6.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.04 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|