C26H35F3O4 — CID 162600873
propan-2-yl (Z)-7-[(1R)-2-oxo-5-[4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoate (PubChem CID 162600873) has the molecular formula C26H35F3O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R)-2-oxo-5-[4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R)-2-oxo-5-[4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 162600873 |
| Molecular Formula | C26H35F3O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R)-2-oxo-5-[4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1C(=O)CCC1CCCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H35F3O4/c1-19(2)33-25(31)14-6-4-3-5-13-23-20(15-16-24(23)30)10-7-8-17-32-22-12-9-11-21(18-22)26(27,28)29/h3,5,9,11-12,18-20,23H,4,6-8,10,13-17H2,1-2H3/b5-3-/t20?,23-/m1/s1 |
| InChIKey | CSUYLIQKNCHGPU-KDMRIWRWSA-N |
| XLogP | 6.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|