C26H34F3NO5 — CID 89095903
propan-2-yl (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3R)-3-nitroso-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 89095903) has the molecular formula C26H34F3NO5 and a molecular weight of 497.55 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3R)-3-nitroso-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3R)-3-nitroso-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 89095903 |
| Molecular Formula | C26H34F3NO5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3R)-3-nitroso-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1[C@@H](O)CC[C@@H]1/C=C/[C@H](COc1cccc(C(F)(F)F)c1)N=O |
| InChI | InChI=1S/C26H34F3NO5/c1-18(2)35-25(32)11-6-4-3-5-10-23-19(13-15-24(23)31)12-14-21(30-33)17-34-22-9-7-8-20(16-22)26(27,28)29/h3,5,7-9,12,14,16,18-19,21,23-24,31H,4,6,10-11,13,15,17H2,1-2H3/b5-3-,14-12+/t19-,21+,23+,24-/m0/s1 |
| InChIKey | LDILTXUCAIDNTG-BLUGAGETSA-N |
| XLogP | 6.23 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|