C26H31F3O5 — CID 66887852
propan-2-yl 7-[2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate (PubChem CID 66887852) has the molecular formula C26H31F3O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is propan-2-yl 7-[2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 66887852 |
| Molecular Formula | C26H31F3O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | propan-2-yl 7-[2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CCC1=C(C=C[C@@H](O)COc2cccc(C(F)(F)F)c2)CCC1=O |
| InChI | InChI=1S/C26H31F3O5/c1-18(2)34-25(32)11-6-4-3-5-10-23-19(13-15-24(23)31)12-14-21(30)17-33-22-9-7-8-20(16-22)26(27,28)29/h3,5,7-9,12,14,16,18,21,30H,4,6,10-11,13,15,17H2,1-2H3/t21-/m1/s1 |
| InChIKey | BFENPDAFVDUQEO-OAQYLSRUSA-N |
| XLogP | 5.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|