C23H33ClO4 — CID 23549465
methyl 7-[5-chloro-3-hydroxy-2-[4-(1-hydroxycyclobutyl)phenyl]cyclopentyl]heptanoate (PubChem CID 23549465) has the molecular formula C23H33ClO4 and a molecular weight of 408.97 g/mol. Its IUPAC name is methyl 7-[5-chloro-3-hydroxy-2-[4-(1-hydroxycyclobutyl)phenyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[5-chloro-3-hydroxy-2-[4-(1-hydroxycyclobutyl)phenyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 23549465 |
| Molecular Formula | C23H33ClO4 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | methyl 7-[5-chloro-3-hydroxy-2-[4-(1-hydroxycyclobutyl)phenyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(Cl)CC(O)C1c1ccc(C2(O)CCC2)cc1 |
| InChI | InChI=1S/C23H33ClO4/c1-28-21(26)8-5-3-2-4-7-18-19(24)15-20(25)22(18)16-9-11-17(12-10-16)23(27)13-6-14-23/h9-12,18-20,22,25,27H,2-8,13-15H2,1H3 |
| InChIKey | VTASWXKZFIHLTQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|