C20H29ClO4 — CID 69365919
methyl 7-[(1R,5R)-5-chloro-3-hydroxy-2-[4-(hydroxymethyl)phenyl]cyclopentyl]heptanoate (PubChem CID 69365919) has the molecular formula C20H29ClO4 and a molecular weight of 368.90 g/mol. Its IUPAC name is methyl 7-[(1R,5R)-5-chloro-3-hydroxy-2-[4-(hydroxymethyl)phenyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,5R)-5-chloro-3-hydroxy-2-[4-(hydroxymethyl)phenyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 69365919 |
| Molecular Formula | C20H29ClO4 |
| Molecular Weight | 368.90 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | methyl 7-[(1R,5R)-5-chloro-3-hydroxy-2-[4-(hydroxymethyl)phenyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1C(c2ccc(CO)cc2)C(O)C[C@H]1Cl |
| InChI | InChI=1S/C20H29ClO4/c1-25-19(24)7-5-3-2-4-6-16-17(21)12-18(23)20(16)15-10-8-14(13-22)9-11-15/h8-11,16-18,20,22-23H,2-7,12-13H2,1H3/t16-,17+,18?,20?/m0/s1 |
| InChIKey | RSIIKWFUMMKNRU-BRJVHFRTSA-N |
| XLogP | 3.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.90 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|