C25H35ClO3 — CID 91589536
7-[(1R,2R)-2-chloro-5-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentyl]hept-5-enoic acid (PubChem CID 91589536) has the molecular formula C25H35ClO3 and a molecular weight of 419.01 g/mol. Its IUPAC name is 7-[(1R,2R)-2-chloro-5-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-chloro-5-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91589536 |
| Molecular Formula | C25H35ClO3 |
| Molecular Weight | 419.01 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 7-[(1R,2R)-2-chloro-5-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1C(c2ccc(C(O)C3CCCCC3)cc2)CC[C@H]1Cl |
| InChI | InChI=1S/C25H35ClO3/c26-23-17-16-21(22(23)10-6-1-2-7-11-24(27)28)18-12-14-20(15-13-18)25(29)19-8-4-3-5-9-19/h1,6,12-15,19,21-23,25,29H,2-5,7-11,16-17H2,(H,27,28)/t21?,22-,23-,25?/m1/s1 |
| InChIKey | GMHHDHQNMPQLEA-NBRGDXIDSA-N |
| XLogP | 6.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.01 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|