C27H39ClO3 — CID 89320515
propan-2-yl (Z)-7-[(1R,2R,5S)-2-chloro-5-(4-hexanoylphenyl)cyclopentyl]hept-5-enoate (PubChem CID 89320515) has the molecular formula C27H39ClO3 and a molecular weight of 447.06 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,5S)-2-chloro-5-(4-hexanoylphenyl)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,5S)-2-chloro-5-(4-hexanoylphenyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 89320515 |
| Molecular Formula | C27H39ClO3 |
| Molecular Weight | 447.06 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,5S)-2-chloro-5-(4-hexanoylphenyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(=O)c1ccc([C@H]2CC[C@@H](Cl)[C@@H]2C/C=C\CCCC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C27H39ClO3/c1-4-5-8-12-26(29)22-16-14-21(15-17-22)23-18-19-25(28)24(23)11-9-6-7-10-13-27(30)31-20(2)3/h6,9,14-17,20,23-25H,4-5,7-8,10-13,18-19H2,1-3H3/b9-6-/t23-,24-,25-/m1/s1 |
| InChIKey | OQQMBKQRLHNPQU-DIGCGKHKSA-N |
| XLogP | 7.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.06 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|