C30H44ClNO5 — CID 123217656
2-morpholin-4-ylethyl 7-[(1R,2S,3R,5R)-5-chloro-2-(4-hexanoylphenyl)-3-hydroxycyclopentyl]hept-5-enoate (PubChem CID 123217656) has the molecular formula C30H44ClNO5 and a molecular weight of 534.14 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 7-[(1R,2S,3R,5R)-5-chloro-2-(4-hexanoylphenyl)-3-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | 2-morpholin-4-ylethyl 7-[(1R,2S,3R,5R)-5-chloro-2-(4-hexanoylphenyl)-3-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 123217656 |
| Molecular Formula | C30H44ClNO5 |
| Molecular Weight | 534.14 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | 2-morpholin-4-ylethyl 7-[(1R,2S,3R,5R)-5-chloro-2-(4-hexanoylphenyl)-3-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(=O)c1ccc([C@@H]2[C@@H](CC=CCCCC(=O)OCCN3CCOCC3)[C@H](Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C30H44ClNO5/c1-2-3-6-10-27(33)23-12-14-24(15-13-23)30-25(26(31)22-28(30)34)9-7-4-5-8-11-29(35)37-21-18-32-16-19-36-20-17-32/h4,7,12-15,25-26,28,30,34H,2-3,5-6,8-11,16-22H2,1H3/t25-,26+,28+,30+/m0/s1 |
| InChIKey | NZTVOKQIQKWYRX-XLGZKVCWSA-N |
| XLogP | 5.51 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.14 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|