C25H34Cl3NO5 — CID 90185578
2-morpholin-4-ylethyl (Z)-7-[(2S,3R,5R)-5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoate (PubChem CID 90185578) has the molecular formula C25H34Cl3NO5 and a molecular weight of 534.91 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl (Z)-7-[(2S,3R,5R)-5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | 2-morpholin-4-ylethyl (Z)-7-[(2S,3R,5R)-5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90185578 |
| Molecular Formula | C25H34Cl3NO5 |
| Molecular Weight | 534.91 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 2-morpholin-4-ylethyl (Z)-7-[(2S,3R,5R)-5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\CC1[C@H](Cl)C[C@@H](O)[C@@H]1COc1cc(Cl)cc(Cl)c1)OCCN1CCOCC1 |
| InChI | InChI=1S/C25H34Cl3NO5/c26-18-13-19(27)15-20(14-18)34-17-22-21(23(28)16-24(22)30)5-3-1-2-4-6-25(31)33-12-9-29-7-10-32-11-8-29/h1,3,13-15,21-24,30H,2,4-12,16-17H2/b3-1-/t21?,22-,23-,24-/m1/s1 |
| InChIKey | CCPSOGQMWPQLFE-WFINVMTQSA-N |
| XLogP | 4.97 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.91 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|